C7H3F6NO2 — CID 173091300
2-cyano-3,4,5,5,5-pentafluoro-4-(fluoromethyl)pent-2-enoic acid (PubChem CID 173091300) has the molecular formula C7H3F6NO2 and a molecular weight of 247.09 g/mol. Its IUPAC name is 2-cyano-3,4,5,5,5-pentafluoro-4-(fluoromethyl)pent-2-enoic acid.
| Compound Name | 2-cyano-3,4,5,5,5-pentafluoro-4-(fluoromethyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 173091300 |
| Molecular Formula | C7H3F6NO2 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 2-cyano-3,4,5,5,5-pentafluoro-4-(fluoromethyl)pent-2-enoic acid |
| SMILES | N#CC(C(=O)O)=C(F)C(F)(CF)C(F)(F)F |
| InChI | InChI=1S/C7H3F6NO2/c8-2-6(10,7(11,12)13)4(9)3(1-14)5(15)16/h2H2,(H,15,16) |
| InChIKey | AFRGKKNOAOJIRG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|