C9HF10NO3 — CID 154321221
5,5,6,6,7,7,7-heptafluoro-3-hydroxy-4-oxo-2-(2,2,2-trifluoroacetyl)hept-2-enenitrile (PubChem CID 154321221) has the molecular formula C9HF10NO3 and a molecular weight of 361.09 g/mol. Its IUPAC name is 5,5,6,6,7,7,7-heptafluoro-3-hydroxy-4-oxo-2-(2,2,2-trifluoroacetyl)hept-2-enenitrile.
| Compound Name | 5,5,6,6,7,7,7-heptafluoro-3-hydroxy-4-oxo-2-(2,2,2-trifluoroacetyl)hept-2-enenitrile |
|---|---|
| PubChem CID | 154321221 |
| Molecular Formula | C9HF10NO3 |
| Molecular Weight | 361.09 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 5,5,6,6,7,7,7-heptafluoro-3-hydroxy-4-oxo-2-(2,2,2-trifluoroacetyl)hept-2-enenitrile |
| SMILES | N#CC(C(=O)C(F)(F)F)=C(O)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9HF10NO3/c10-6(11,8(15,16)9(17,18)19)5(23)3(21)2(1-20)4(22)7(12,13)14/h21H |
| InChIKey | ZAZXIDIVGCFHCG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|