C12H19NO2 — CID 15554300
(Z)-2-(2,2-dimethylpropanoyl)-3-hydroxy-4,4-dimethylpent-2-enenitrile (PubChem CID 15554300) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (Z)-2-(2,2-dimethylpropanoyl)-3-hydroxy-4,4-dimethylpent-2-enenitrile.
| Compound Name | (Z)-2-(2,2-dimethylpropanoyl)-3-hydroxy-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 15554300 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (Z)-2-(2,2-dimethylpropanoyl)-3-hydroxy-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(C)(C)C(=O)/C(C#N)=C(\O)C(C)(C)C |
| InChI | InChI=1S/C12H19NO2/c1-11(2,3)9(14)8(7-13)10(15)12(4,5)6/h14H,1-6H3/b9-8- |
| InChIKey | BVZWJUFREKIXOW-HJWRWDBZSA-N |
| XLogP | 2.98 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|