About sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate
sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate (PubChem CID 173140327) has the molecular formula C6H5F3NNaO3
and a molecular weight of 219.09 g/mol. Its IUPAC name is sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate.
Molecular Properties
| Compound Name | sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate |
| PubChem CID | 173140327 |
| Molecular Formula | C6H5F3NNaO3 |
| Molecular Weight | 219.09 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C(C#N)=C(\O)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C6H4F3NO3.Na.H/c1-13-5(12)3(2-10)4(11)6(7,8)9;;/h11H,1H3;;/q;+1;-1/b4-3-;; |
| InChIKey | FHUQLBOJDRELDQ-GSBNXNDCSA-N |
| XLogP | -1.83 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.09 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate?
The IUPAC name of sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate (CID 173140327) is sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate.
What is the SMILES notation for sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate?
The canonical SMILES for sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate is COC(=O)/C(C#N)=C(\O)C(F)(F)F.[H-].[Na+].
What is the InChIKey of sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate?
The InChIKey is FHUQLBOJDRELDQ-GSBNXNDCSA-N. The full InChI is InChI=1S/C6H4F3NO3.Na.H/c1-13-5(12)3(2-10)4(11)6(7,8)9;;/h11H,1H3;;/q;+1;-1/b4-3-;;.
What are the key properties of sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate?
sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate has a molecular weight of 219.09 g/mol, XLogP of -1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;methyl (Z)-2-cyano-4,4,4-trifluoro-3-hydroxybut-2-enoate is sourced from PubChem (CID 173140327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).