C9H9F5N2O — CID 117064003
(Z)-3-amino-4-methyl-2-(2,2,3,3,3-pentafluoropropanoyl)pent-2-enenitrile (PubChem CID 117064003) has the molecular formula C9H9F5N2O and a molecular weight of 256.17 g/mol. Its IUPAC name is (Z)-3-amino-4-methyl-2-(2,2,3,3,3-pentafluoropropanoyl)pent-2-enenitrile.
| Compound Name | (Z)-3-amino-4-methyl-2-(2,2,3,3,3-pentafluoropropanoyl)pent-2-enenitrile |
|---|---|
| PubChem CID | 117064003 |
| Molecular Formula | C9H9F5N2O |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | (Z)-3-amino-4-methyl-2-(2,2,3,3,3-pentafluoropropanoyl)pent-2-enenitrile |
| SMILES | CC(C)/C(N)=C(\C#N)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F5N2O/c1-4(2)6(16)5(3-15)7(17)8(10,11)9(12,13)14/h4H,16H2,1-2H3/b6-5- |
| InChIKey | XTLAHWQUAVXYLV-WAYWQWQTSA-N |
| XLogP | 2.15 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|