C6F6N2 — CID 5366002
(Z)-2-fluoro-3-(1,1,2,2,2-pentafluoroethyl)but-2-enedinitrile (PubChem CID 5366002) has the molecular formula C6F6N2 and a molecular weight of 214.07 g/mol. Its IUPAC name is (Z)-2-fluoro-3-(1,1,2,2,2-pentafluoroethyl)but-2-enedinitrile.
| Compound Name | (Z)-2-fluoro-3-(1,1,2,2,2-pentafluoroethyl)but-2-enedinitrile |
|---|---|
| PubChem CID | 5366002 |
| Molecular Formula | C6F6N2 |
| Molecular Weight | 214.07 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | (Z)-2-fluoro-3-(1,1,2,2,2-pentafluoroethyl)but-2-enedinitrile |
| SMILES | N#C/C(F)=C(\C#N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F6N2/c7-4(2-14)3(1-13)5(8,9)6(10,11)12/b4-3- |
| InChIKey | WCYOTBXXOXFXCS-ARJAWSKDSA-N |
| XLogP | 2.45 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.07 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|