C9F15IN2O — CID 87580753
bis(2,2,3,3,3-pentafluoropropanenitrile);2,2,3,3,3-pentafluoropropanoyl iodide (PubChem CID 87580753) has the molecular formula C9F15IN2O and a molecular weight of 563.99 g/mol. Its IUPAC name is bis(2,2,3,3,3-pentafluoropropanenitrile);2,2,3,3,3-pentafluoropropanoyl iodide.
| Compound Name | bis(2,2,3,3,3-pentafluoropropanenitrile);2,2,3,3,3-pentafluoropropanoyl iodide |
|---|---|
| PubChem CID | 87580753 |
| Molecular Formula | C9F15IN2O |
| Molecular Weight | 563.99 g/mol |
| Exact Mass | 563.88 |
| IUPAC Name | bis(2,2,3,3,3-pentafluoropropanenitrile);2,2,3,3,3-pentafluoropropanoyl iodide |
| SMILES | N#CC(F)(F)C(F)(F)F.N#CC(F)(F)C(F)(F)F.O=C(I)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3F5IO.2C3F5N/c4-2(5,1(9)10)3(6,7)8;2*4-2(5,1-9)3(6,7)8 |
| InChIKey | ULEAJSOTNXXMRP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.99 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|