C4H4F6N2 — CID 169085392
1,3,3,4,4,4-hexafluorobut-1-ene-1,2-diamine (PubChem CID 169085392) has the molecular formula C4H4F6N2 and a molecular weight of 194.08 g/mol. Its IUPAC name is 1,3,3,4,4,4-hexafluorobut-1-ene-1,2-diamine.
| Compound Name | 1,3,3,4,4,4-hexafluorobut-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 169085392 |
| Molecular Formula | C4H4F6N2 |
| Molecular Weight | 194.08 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 1,3,3,4,4,4-hexafluorobut-1-ene-1,2-diamine |
| SMILES | NC(F)=C(N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H4F6N2/c5-2(12)1(11)3(6,7)4(8,9)10/h11-12H2 |
| InChIKey | PLXLSTPOFFMFIR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.08 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|