C20H16F20N2O2 — CID 11204761
(5E,15E)-5,16-diamino-1,1,1,2,2,3,3,4,4,6,15,17,17,18,18,19,19,20,20,20-icosafluoroicosa-5,15-diene-7,14-dione (PubChem CID 11204761) has the molecular formula C20H16F20N2O2 and a molecular weight of 696.32 g/mol. Its IUPAC name is (5E,15E)-5,16-diamino-1,1,1,2,2,3,3,4,4,6,15,17,17,18,18,19,19,20,20,20-icosafluoroicosa-5,15-diene-7,14-dione.
| Compound Name | (5E,15E)-5,16-diamino-1,1,1,2,2,3,3,4,4,6,15,17,17,18,18,19,19,20,20,20-icosafluoroicosa-5,15-diene-7,14-dione |
|---|---|
| PubChem CID | 11204761 |
| Molecular Formula | C20H16F20N2O2 |
| Molecular Weight | 696.32 g/mol |
| Exact Mass | 696.09 |
| IUPAC Name | (5E,15E)-5,16-diamino-1,1,1,2,2,3,3,4,4,6,15,17,17,18,18,19,19,20,20,20-icosafluoroicosa-5,15-diene-7,14-dione |
| SMILES | N/C(=C(/F)C(=O)CCCCCCC(=O)/C(F)=C(\N)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H16F20N2O2/c21-9(11(41)13(23,24)15(27,28)17(31,32)19(35,36)37)7(43)5-3-1-2-4-6-8(44)10(22)12(42)14(25,26)16(29,30)18(33,34)20(38,39)40/h1-6,41-42H2/b11-9+,12-10+ |
| InChIKey | VURYLUFEXKJTND-WGDLNXRISA-N |
| XLogP | 7.68 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.32 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|