C8H4F12N2 — CID 177383651
(2Z,4E)-1,1,1,6,6,6-hexafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene-2,5-diamine (PubChem CID 177383651) has the molecular formula C8H4F12N2 and a molecular weight of 356.11 g/mol. Its IUPAC name is (2Z,4E)-1,1,1,6,6,6-hexafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene-2,5-diamine.
| Compound Name | (2Z,4E)-1,1,1,6,6,6-hexafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 177383651 |
| Molecular Formula | C8H4F12N2 |
| Molecular Weight | 356.11 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (2Z,4E)-1,1,1,6,6,6-hexafluoro-3,4-bis(trifluoromethyl)hexa-2,4-diene-2,5-diamine |
| SMILES | N/C(=C(C(=C(\N)C(F)(F)F)/C(F)(F)F)\C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F12N2/c9-5(10,11)1(3(21)7(15,16)17)2(6(12,13)14)4(22)8(18,19)20/h21-22H2/b3-1-,4-2+ |
| InChIKey | OXOUPAGCACKSRH-HSFFGMMNSA-N |
| XLogP | 3.66 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.11 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|