C6H8ClF3N2 — CID 147493690
3-amino-4,4,4-trifluoro-N,2-dimethylbut-2-enimidoyl chloride (PubChem CID 147493690) has the molecular formula C6H8ClF3N2 and a molecular weight of 200.59 g/mol. Its IUPAC name is 3-amino-4,4,4-trifluoro-N,2-dimethylbut-2-enimidoyl chloride.
| Compound Name | 3-amino-4,4,4-trifluoro-N,2-dimethylbut-2-enimidoyl chloride |
|---|---|
| PubChem CID | 147493690 |
| Molecular Formula | C6H8ClF3N2 |
| Molecular Weight | 200.59 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 3-amino-4,4,4-trifluoro-N,2-dimethylbut-2-enimidoyl chloride |
| SMILES | C/N=C(\Cl)C(C)=C(N)C(F)(F)F |
| InChI | InChI=1S/C6H8ClF3N2/c1-3(5(7)12-2)4(11)6(8,9)10/h11H2,1-2H3/b4-3?,12-5- |
| InChIKey | PQOGQDUXLGOWFP-CGPLYMGNSA-N |
| XLogP | 2.05 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.59 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|