About N'-methylcarbamimidoyl fluoride
N'-methylcarbamimidoyl fluoride (PubChem CID 141017236) has the molecular formula C2H5FN2
and a molecular weight of 76.07 g/mol. Its IUPAC name is N'-methylcarbamimidoyl fluoride.
Molecular Properties
| Compound Name | N'-methylcarbamimidoyl fluoride |
| PubChem CID | 141017236 |
| Molecular Formula | C2H5FN2 |
| Molecular Weight | 76.07 g/mol |
| Exact Mass | 76.04 |
| IUPAC Name | N'-methylcarbamimidoyl fluoride |
| SMILES | C/N=C(/N)F |
| InChI | InChI=1S/C2H5FN2/c1-5-2(3)4/h1H3,(H2,4,5) |
| InChIKey | GOBMOTRSJMBWGJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.07 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-methylcarbamimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylcarbamimidoyl fluoride?
The IUPAC name of N'-methylcarbamimidoyl fluoride (CID 141017236) is N'-methylcarbamimidoyl fluoride.
What is the SMILES notation for N'-methylcarbamimidoyl fluoride?
The canonical SMILES for N'-methylcarbamimidoyl fluoride is C/N=C(/N)F.
What is the InChIKey of N'-methylcarbamimidoyl fluoride?
The InChIKey is GOBMOTRSJMBWGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5FN2/c1-5-2(3)4/h1H3,(H2,4,5).
What are the key properties of N'-methylcarbamimidoyl fluoride?
N'-methylcarbamimidoyl fluoride has a molecular weight of 76.07 g/mol, XLogP of -0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylcarbamimidoyl fluoride is sourced from PubChem (CID 141017236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).