C6H13N3 — CID 145170884
1,2-dimethyl-1-prop-1-en-2-ylguanidine (PubChem CID 145170884) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is 1,2-dimethyl-1-prop-1-en-2-ylguanidine.
| Compound Name | 1,2-dimethyl-1-prop-1-en-2-ylguanidine |
|---|---|
| PubChem CID | 145170884 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 1,2-dimethyl-1-prop-1-en-2-ylguanidine |
| SMILES | C=C(C)N(C)/C(N)=N/C |
| InChI | InChI=1S/C6H13N3/c1-5(2)9(4)6(7)8-3/h1H2,2-4H3,(H2,7,8) |
| InChIKey | JBRBVGUIVYKWCV-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|