About ethane;methane;2-methylguanidine
ethane;methane;2-methylguanidine (PubChem CID 159190146) has the molecular formula C5H17N3
and a molecular weight of 119.21 g/mol. Its IUPAC name is ethane;methane;2-methylguanidine.
Molecular Properties
| Compound Name | ethane;methane;2-methylguanidine |
| PubChem CID | 159190146 |
| Molecular Formula | C5H17N3 |
| Molecular Weight | 119.21 g/mol |
| Exact Mass | 119.14 |
| IUPAC Name | ethane;methane;2-methylguanidine |
| SMILES | C.CC.CN=C(N)N |
| InChI | InChI=1S/C2H7N3.C2H6.CH4/c1-5-2(3)4;1-2;/h1H3,(H4,3,4,5);1-2H3;1H4 |
| InChIKey | KNZGLRCQCMATMA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;2-methylguanidine?
The IUPAC name of ethane;methane;2-methylguanidine (CID 159190146) is ethane;methane;2-methylguanidine.
What is the SMILES notation for ethane;methane;2-methylguanidine?
The canonical SMILES for ethane;methane;2-methylguanidine is C.CC.CN=C(N)N.
What is the InChIKey of ethane;methane;2-methylguanidine?
The InChIKey is KNZGLRCQCMATMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N3.C2H6.CH4/c1-5-2(3)4;1-2;/h1H3,(H4,3,4,5);1-2H3;1H4.
What are the key properties of ethane;methane;2-methylguanidine?
ethane;methane;2-methylguanidine has a molecular weight of 119.21 g/mol, XLogP of 0.55, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;2-methylguanidine is sourced from PubChem (CID 159190146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).