2,2,2-trifluoro-N'-hydroxyethanimidamide chloride

C2H3ClF3N2O- — CID 157440651

IUPAC2,2,2-trifluoro-N'-hydroxyethanimidamide chloride
SMILESNC(=NO)C(F)(F)F.[Cl-]
InChIInChI=1S/C2H3F3N2O.ClH/c3-2(4,5)1(6)7-8;/h8H,(H2,6,7);1H/p-1
InChIKeyBRQCGBWPYBIQBQ-UHFFFAOYSA-M
MW163.51 g/mol
LogP-2.70
Rot. Bonds

About 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride

2,2,2-trifluoro-N'-hydroxyethanimidamide chloride (PubChem CID 157440651) has the molecular formula C2H3ClF3N2O- and a molecular weight of 163.51 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride.

Molecular Properties

Compound Name2,2,2-trifluoro-N'-hydroxyethanimidamide chloride
PubChem CID157440651
Molecular FormulaC2H3ClF3N2O-
Molecular Weight163.51 g/mol
Exact Mass162.99
IUPAC Name2,2,2-trifluoro-N'-hydroxyethanimidamide chloride
SMILESNC(=NO)C(F)(F)F.[Cl-]
InChIInChI=1S/C2H3F3N2O.ClH/c3-2(4,5)1(6)7-8;/h8H,(H2,6,7);1H/p-1
InChIKeyBRQCGBWPYBIQBQ-UHFFFAOYSA-M
XLogP-2.70
TPSA58.61 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.51
LogP ≤ 5-2.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride?
The IUPAC name of 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride (CID 157440651) is 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride.
What is the SMILES notation for 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride?
The canonical SMILES for 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride is NC(=NO)C(F)(F)F.[Cl-].
What is the InChIKey of 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride?
The InChIKey is BRQCGBWPYBIQBQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H3F3N2O.ClH/c3-2(4,5)1(6)7-8;/h8H,(H2,6,7);1H/p-1.
What are the key properties of 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride?
2,2,2-trifluoro-N'-hydroxyethanimidamide chloride has a molecular weight of 163.51 g/mol, XLogP of -2.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N'-hydroxyethanimidamide chloride is sourced from PubChem (CID 157440651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).