About azanide;N'-hydroxyethanimidamide;tetrakis(yttrium)
azanide;N'-hydroxyethanimidamide;tetrakis(yttrium) (PubChem CID 58774840) has the molecular formula C2H7N3OY4-2
and a molecular weight of 444.72 g/mol. Its IUPAC name is azanide;N'-hydroxyethanimidamide;tetrakis(yttrium).
Molecular Properties
| Compound Name | azanide;N'-hydroxyethanimidamide;tetrakis(yttrium) |
| PubChem CID | 58774840 |
| Molecular Formula | C2H7N3OY4-2 |
| Molecular Weight | 444.72 g/mol |
| Exact Mass | 444.68 |
| IUPAC Name | azanide;N'-hydroxyethanimidamide;tetrakis(yttrium) |
| SMILES | [CH2-]/C(N)=N/O.[NH2-].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C2H5N2O.H2N.4Y/c1-2(3)4-5;;;;;/h5H,1H2,(H2,3,4);1H2;;;;/q2*-1;;;; |
| InChIKey | RIPXVKNWQBSEAN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 92.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.72 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanide;N'-hydroxyethanimidamide;tetrakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;N'-hydroxyethanimidamide;tetrakis(yttrium)?
The IUPAC name of azanide;N'-hydroxyethanimidamide;tetrakis(yttrium) (CID 58774840) is azanide;N'-hydroxyethanimidamide;tetrakis(yttrium).
What is the SMILES notation for azanide;N'-hydroxyethanimidamide;tetrakis(yttrium)?
The canonical SMILES for azanide;N'-hydroxyethanimidamide;tetrakis(yttrium) is [CH2-]/C(N)=N/O.[NH2-].[Y].[Y].[Y].[Y].
What is the InChIKey of azanide;N'-hydroxyethanimidamide;tetrakis(yttrium)?
The InChIKey is RIPXVKNWQBSEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N2O.H2N.4Y/c1-2(3)4-5;;;;;/h5H,1H2,(H2,3,4);1H2;;;;/q2*-1;;;;.
What are the key properties of azanide;N'-hydroxyethanimidamide;tetrakis(yttrium)?
azanide;N'-hydroxyethanimidamide;tetrakis(yttrium) has a molecular weight of 444.72 g/mol, XLogP of 0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;N'-hydroxyethanimidamide;tetrakis(yttrium) is sourced from PubChem (CID 58774840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).