About 1-N'-hydroxy-2-N'-oxidoethanediimidamide
1-N'-hydroxy-2-N'-oxidoethanediimidamide (PubChem CID 135698683) has the molecular formula C2H5N4O2-
and a molecular weight of 117.09 g/mol. Its IUPAC name is 1-N'-hydroxy-2-N'-oxidoethanediimidamide.
Molecular Properties
| Compound Name | 1-N'-hydroxy-2-N'-oxidoethanediimidamide |
| PubChem CID | 135698683 |
| Molecular Formula | C2H5N4O2- |
| Molecular Weight | 117.09 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 1-N'-hydroxy-2-N'-oxidoethanediimidamide |
| SMILES | NC(=N\[O-])/C(N)=N/O |
| InChI | InChI=1S/C2H6N4O2/c3-1(5-7)2(4)6-8/h7-8H,(H2,3,5)(H2,4,6)/p-1 |
| InChIKey | BFXWFQSYMVKOCJ-UHFFFAOYSA-M |
| XLogP | -1.41 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.09 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-hydroxy-2-N'-oxidoethanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-hydroxy-2-N'-oxidoethanediimidamide?
The IUPAC name of 1-N'-hydroxy-2-N'-oxidoethanediimidamide (CID 135698683) is 1-N'-hydroxy-2-N'-oxidoethanediimidamide.
What is the SMILES notation for 1-N'-hydroxy-2-N'-oxidoethanediimidamide?
The canonical SMILES for 1-N'-hydroxy-2-N'-oxidoethanediimidamide is NC(=N\[O-])/C(N)=N/O.
What is the InChIKey of 1-N'-hydroxy-2-N'-oxidoethanediimidamide?
The InChIKey is BFXWFQSYMVKOCJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H6N4O2/c3-1(5-7)2(4)6-8/h7-8H,(H2,3,5)(H2,4,6)/p-1.
What are the key properties of 1-N'-hydroxy-2-N'-oxidoethanediimidamide?
1-N'-hydroxy-2-N'-oxidoethanediimidamide has a molecular weight of 117.09 g/mol, XLogP of -1.41, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-hydroxy-2-N'-oxidoethanediimidamide is sourced from PubChem (CID 135698683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).