C4H12N8O4Pt — CID 135460051
bis(1-N',2-N'-dihydroxyethanediimidamide);platinum (PubChem CID 135460051) has the molecular formula C4H12N8O4Pt and a molecular weight of 431.27 g/mol. Its IUPAC name is bis(1-N',2-N'-dihydroxyethanediimidamide);platinum.
| Compound Name | bis(1-N',2-N'-dihydroxyethanediimidamide);platinum |
|---|---|
| PubChem CID | 135460051 |
| Molecular Formula | C4H12N8O4Pt |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | bis(1-N',2-N'-dihydroxyethanediimidamide);platinum |
| SMILES | NC(=NO)C(N)=NO.NC(=NO)C(N)=NO.[Pt] |
| InChI | InChI=1S/2C2H6N4O2.Pt/c2*3-1(5-7)2(4)6-8;/h2*7-8H,(H2,3,5)(H2,4,6); |
| InChIKey | HJMASQKCCMDTFO-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 234.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|