C5H6ClF3N2 — CID 134987450
N'-[(Z)-1-chloroprop-1-enyl]-2,2,2-trifluoroethanimidamide (PubChem CID 134987450) has the molecular formula C5H6ClF3N2 and a molecular weight of 186.56 g/mol. Its IUPAC name is N'-[(Z)-1-chloroprop-1-enyl]-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-[(Z)-1-chloroprop-1-enyl]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 134987450 |
| Molecular Formula | C5H6ClF3N2 |
| Molecular Weight | 186.56 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | N'-[(Z)-1-chloroprop-1-enyl]-2,2,2-trifluoroethanimidamide |
| SMILES | C/C=C(Cl)/N=C(/N)C(F)(F)F |
| InChI | InChI=1S/C5H6ClF3N2/c1-2-3(6)11-4(10)5(7,8)9/h2H,1H3,(H2,10,11)/b3-2+ |
| InChIKey | QDUQBGVTYVLFGB-NSCUHMNNSA-N |
| XLogP | 2.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|