C8H12ClF3N2 — CID 134920878
N'-(1-chloro-2-ethylbut-1-enyl)-2,2,2-trifluoroethanimidamide (PubChem CID 134920878) has the molecular formula C8H12ClF3N2 and a molecular weight of 228.64 g/mol. Its IUPAC name is N'-(1-chloro-2-ethylbut-1-enyl)-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-(1-chloro-2-ethylbut-1-enyl)-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 134920878 |
| Molecular Formula | C8H12ClF3N2 |
| Molecular Weight | 228.64 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | N'-(1-chloro-2-ethylbut-1-enyl)-2,2,2-trifluoroethanimidamide |
| SMILES | CCC(CC)=C(Cl)/N=C(/N)C(F)(F)F |
| InChI | InChI=1S/C8H12ClF3N2/c1-3-5(4-2)6(9)14-7(13)8(10,11)12/h3-4H2,1-2H3,(H2,13,14) |
| InChIKey | WEGSYNYJUGBUBA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.64 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|