C8H13F3N2OS — CID 162597667
(3,3,3-trifluoro-2-methylpropyl) N-carbamoylpropanimidothioate (PubChem CID 162597667) has the molecular formula C8H13F3N2OS and a molecular weight of 242.27 g/mol. Its IUPAC name is (3,3,3-trifluoro-2-methylpropyl) N-carbamoylpropanimidothioate.
| Compound Name | (3,3,3-trifluoro-2-methylpropyl) N-carbamoylpropanimidothioate |
|---|---|
| PubChem CID | 162597667 |
| Molecular Formula | C8H13F3N2OS |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (3,3,3-trifluoro-2-methylpropyl) N-carbamoylpropanimidothioate |
| SMILES | CCC(=NC(N)=O)SCC(C)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2OS/c1-3-6(13-7(12)14)15-4-5(2)8(9,10)11/h5H,3-4H2,1-2H3,(H2,12,14) |
| InChIKey | SDWCBTGDIWYAKG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|