C9H7F5N2O2 — CID 172826560
2,2-difluoro-N'-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethanimidamide (PubChem CID 172826560) has the molecular formula C9H7F5N2O2 and a molecular weight of 270.16 g/mol. Its IUPAC name is 2,2-difluoro-N'-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethanimidamide.
| Compound Name | 2,2-difluoro-N'-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 172826560 |
| Molecular Formula | C9H7F5N2O2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2,2-difluoro-N'-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethanimidamide |
| SMILES | NC(=NO)C(F)(F)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F5N2O2/c10-8(11,7(15)16-17)5-1-3-6(4-2-5)18-9(12,13)14/h1-4,17H,(H2,15,16) |
| InChIKey | UYCUNMTTWLOQFA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|