C14H13F3N2O3 — CID 87590365
(E)-2-cyano-3-hydroxy-4-methyl-N-[4-(trifluoromethyl)phenoxy]pent-2-enamide (PubChem CID 87590365) has the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. Its IUPAC name is (E)-2-cyano-3-hydroxy-4-methyl-N-[4-(trifluoromethyl)phenoxy]pent-2-enamide.
| Compound Name | (E)-2-cyano-3-hydroxy-4-methyl-N-[4-(trifluoromethyl)phenoxy]pent-2-enamide |
|---|---|
| PubChem CID | 87590365 |
| Molecular Formula | C14H13F3N2O3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (E)-2-cyano-3-hydroxy-4-methyl-N-[4-(trifluoromethyl)phenoxy]pent-2-enamide |
| SMILES | CC(C)/C(O)=C(/C#N)C(=O)NOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3N2O3/c1-8(2)12(20)11(7-18)13(21)19-22-10-5-3-9(4-6-10)14(15,16)17/h3-6,8,20H,1-2H3,(H,19,21)/b12-11+ |
| InChIKey | FJTCUQDZDKTYQN-VAWYXSNFSA-N |
| XLogP | 3.11 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|