C21H23N3O — CID 173093573
N-[(4-methylphenyl)methyl]-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]ethanamine (PubChem CID 173093573) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]ethanamine.
| Compound Name | N-[(4-methylphenyl)methyl]-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]ethanamine |
|---|---|
| PubChem CID | 173093573 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]ethanamine |
| SMILES | Cc1ccc(CNC(C)c2cccc(Oc3cncc(C)n3)c2)cc1 |
| InChI | InChI=1S/C21H23N3O/c1-15-7-9-18(10-8-15)13-23-17(3)19-5-4-6-20(11-19)25-21-14-22-12-16(2)24-21/h4-12,14,17,23H,13H2,1-3H3 |
| InChIKey | DTNQXSDJYRQGMD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |