C45H91NO7S — CID 173095803
3-carboxy-2-octyl-2-sulfoundecanoate;methyl(trioctyl)azanium (PubChem CID 173095803) has the molecular formula C45H91NO7S and a molecular weight of 790.29 g/mol. Its IUPAC name is 3-carboxy-2-octyl-2-sulfoundecanoate;methyl(trioctyl)azanium.
| Compound Name | 3-carboxy-2-octyl-2-sulfoundecanoate;methyl(trioctyl)azanium |
|---|---|
| PubChem CID | 173095803 |
| Molecular Formula | C45H91NO7S |
| Molecular Weight | 790.29 g/mol |
| Exact Mass | 789.65 |
| IUPAC Name | 3-carboxy-2-octyl-2-sulfoundecanoate;methyl(trioctyl)azanium |
| SMILES | CCCCCCCCC(C(=O)O)C(CCCCCCCC)(C(=O)[O-])S(=O)(=O)O.CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C25H54N.C20H38O7S/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;1-3-5-7-9-11-13-15-17(18(21)22)20(19(23)24,28(25,26)27)16-14-12-10-8-6-4-2/h5-25H2,1-4H3;17H,3-16H2,1-2H3,(H,21,22)(H,23,24)(H,25,26,27)/q+1;/p-1 |
| InChIKey | STCVZEFIPXWPPD-UHFFFAOYSA-M |
| XLogP | 12.08 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.29 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|