C16H31NaO7S — CID 173009804
sodium;2,3-dihexyl-2-sulfobutanedioic acid;hydride (PubChem CID 173009804) has the molecular formula C16H31NaO7S and a molecular weight of 390.47 g/mol. Its IUPAC name is sodium;2,3-dihexyl-2-sulfobutanedioic acid;hydride.
| Compound Name | sodium;2,3-dihexyl-2-sulfobutanedioic acid;hydride |
|---|---|
| PubChem CID | 173009804 |
| Molecular Formula | C16H31NaO7S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | sodium;2,3-dihexyl-2-sulfobutanedioic acid;hydride |
| SMILES | CCCCCCC(C(=O)O)C(CCCCCC)(C(=O)O)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C16H30O7S.Na.H/c1-3-5-7-9-11-13(14(17)18)16(15(19)20,24(21,22)23)12-10-8-6-4-2;;/h13H,3-12H2,1-2H3,(H,17,18)(H,19,20)(H,21,22,23);;/q;+1;-1 |
| InChIKey | IONYQUCYOKYWEA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|