C30H58O7S — CID 139728429
2,2-di(nonyl)-3-(8-sulfooctyl)butanedioic acid (PubChem CID 139728429) has the molecular formula C30H58O7S and a molecular weight of 562.85 g/mol. Its IUPAC name is 2,2-di(nonyl)-3-(8-sulfooctyl)butanedioic acid.
| Compound Name | 2,2-di(nonyl)-3-(8-sulfooctyl)butanedioic acid |
|---|---|
| PubChem CID | 139728429 |
| Molecular Formula | C30H58O7S |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | 2,2-di(nonyl)-3-(8-sulfooctyl)butanedioic acid |
| SMILES | CCCCCCCCCC(CCCCCCCCC)(C(=O)O)C(CCCCCCCCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C30H58O7S/c1-3-5-7-9-12-16-20-24-30(29(33)34,25-21-17-13-10-8-6-4-2)27(28(31)32)23-19-15-11-14-18-22-26-38(35,36)37/h27H,3-26H2,1-2H3,(H,31,32)(H,33,34)(H,35,36,37) |
| InChIKey | WRHFZIAVTHLJEF-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|