C27H50O6 — CID 91451274
2-(2-heptoxy-2-oxoethyl)-2,3-diheptylbutanedioic acid (PubChem CID 91451274) has the molecular formula C27H50O6 and a molecular weight of 470.69 g/mol. Its IUPAC name is 2-(2-heptoxy-2-oxoethyl)-2,3-diheptylbutanedioic acid.
| Compound Name | 2-(2-heptoxy-2-oxoethyl)-2,3-diheptylbutanedioic acid |
|---|---|
| PubChem CID | 91451274 |
| Molecular Formula | C27H50O6 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | 2-(2-heptoxy-2-oxoethyl)-2,3-diheptylbutanedioic acid |
| SMILES | CCCCCCCOC(=O)CC(CCCCCCC)(C(=O)O)C(CCCCCCC)C(=O)O |
| InChI | InChI=1S/C27H50O6/c1-4-7-10-13-16-19-23(25(29)30)27(26(31)32,20-17-14-11-8-5-2)22-24(28)33-21-18-15-12-9-6-3/h23H,4-22H2,1-3H3,(H,29,30)(H,31,32) |
| InChIKey | PWQDECNVJOYRLL-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|