2,3-dihexyl-2-hydroxybutanedioic acid

C16H30O5 — CID 22274742

IUPAC2,3-dihexyl-2-hydroxybutanedioic acid
SMILESCCCCCCC(C(=O)O)C(O)(CCCCCC)C(=O)O
InChIInChI=1S/C16H30O5/c1-3-5-7-9-11-13(14(17)18)16(21,15(19)20)12-10-8-6-4-2/h13,21H,3-12H2,1-2H3,(H,17,18)(H,19,20)
InChIKeyXBHGONMLWHFBPU-UHFFFAOYSA-N
MW302.41 g/mol
LogP3.44
Rot. Bonds13

About 2,3-dihexyl-2-hydroxybutanedioic acid

2,3-dihexyl-2-hydroxybutanedioic acid (PubChem CID 22274742) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is 2,3-dihexyl-2-hydroxybutanedioic acid.

Molecular Properties

Compound Name2,3-dihexyl-2-hydroxybutanedioic acid
PubChem CID22274742
Molecular FormulaC16H30O5
Molecular Weight302.41 g/mol
Exact Mass302.21
IUPAC Name2,3-dihexyl-2-hydroxybutanedioic acid
SMILESCCCCCCC(C(=O)O)C(O)(CCCCCC)C(=O)O
InChIInChI=1S/C16H30O5/c1-3-5-7-9-11-13(14(17)18)16(21,15(19)20)12-10-8-6-4-2/h13,21H,3-12H2,1-2H3,(H,17,18)(H,19,20)
InChIKeyXBHGONMLWHFBPU-UHFFFAOYSA-N
XLogP3.44
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds13
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.41
LogP ≤ 53.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,3-dihexyl-2-hydroxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihexyl-2-hydroxybutanedioic acid?
The IUPAC name of 2,3-dihexyl-2-hydroxybutanedioic acid (CID 22274742) is 2,3-dihexyl-2-hydroxybutanedioic acid.
What is the SMILES notation for 2,3-dihexyl-2-hydroxybutanedioic acid?
The canonical SMILES for 2,3-dihexyl-2-hydroxybutanedioic acid is CCCCCCC(C(=O)O)C(O)(CCCCCC)C(=O)O.
What is the InChIKey of 2,3-dihexyl-2-hydroxybutanedioic acid?
The InChIKey is XBHGONMLWHFBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O5/c1-3-5-7-9-11-13(14(17)18)16(21,15(19)20)12-10-8-6-4-2/h13,21H,3-12H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 2,3-dihexyl-2-hydroxybutanedioic acid?
2,3-dihexyl-2-hydroxybutanedioic acid has a molecular weight of 302.41 g/mol, XLogP of 3.44, 13 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihexyl-2-hydroxybutanedioic acid is sourced from PubChem (CID 22274742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).