C16H30O5 — CID 22274740
2-hydroxy-2,3-bis(4-methylpentyl)butanedioic acid (PubChem CID 22274740) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is 2-hydroxy-2,3-bis(4-methylpentyl)butanedioic acid.
| Compound Name | 2-hydroxy-2,3-bis(4-methylpentyl)butanedioic acid |
|---|---|
| PubChem CID | 22274740 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-hydroxy-2,3-bis(4-methylpentyl)butanedioic acid |
| SMILES | CC(C)CCCC(C(=O)O)C(O)(CCCC(C)C)C(=O)O |
| InChI | InChI=1S/C16H30O5/c1-11(2)7-5-9-13(14(17)18)16(21,15(19)20)10-6-8-12(3)4/h11-13,21H,5-10H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | UMADSUMZHVLXOZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |