C20H38O5 — CID 22376992
2-hydroxy-2,3-dioctylbutanedioic acid (PubChem CID 22376992) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-hydroxy-2,3-dioctylbutanedioic acid.
| Compound Name | 2-hydroxy-2,3-dioctylbutanedioic acid |
|---|---|
| PubChem CID | 22376992 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 2-hydroxy-2,3-dioctylbutanedioic acid |
| SMILES | CCCCCCCCC(C(=O)O)C(O)(CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C20H38O5/c1-3-5-7-9-11-13-15-17(18(21)22)20(25,19(23)24)16-14-12-10-8-6-4-2/h17,25H,3-16H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | FNEMZLHHBSKBFC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|