C21H40NO5P — CID 87740145
2-(3-amino-3-oxopropyl)-3-hydroxy-6,10,14-trimethyl-3-phosphorosopentadecanoic acid (PubChem CID 87740145) has the molecular formula C21H40NO5P and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-(3-amino-3-oxopropyl)-3-hydroxy-6,10,14-trimethyl-3-phosphorosopentadecanoic acid.
| Compound Name | 2-(3-amino-3-oxopropyl)-3-hydroxy-6,10,14-trimethyl-3-phosphorosopentadecanoic acid |
|---|---|
| PubChem CID | 87740145 |
| Molecular Formula | C21H40NO5P |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 2-(3-amino-3-oxopropyl)-3-hydroxy-6,10,14-trimethyl-3-phosphorosopentadecanoic acid |
| SMILES | CC(C)CCCC(C)CCCC(C)CCC(O)(P=O)C(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H40NO5P/c1-15(2)7-5-8-16(3)9-6-10-17(4)13-14-21(26,28-27)18(20(24)25)11-12-19(22)23/h15-18,26H,5-14H2,1-4H3,(H2,22,23)(H,24,25) |
| InChIKey | KVLNDZTVZUIDEY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|