C10H8BrNO3 — CID 173096573
4-(2-bromophenyl)-1,3-dioxole-2-carboxamide (PubChem CID 173096573) has the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. Its IUPAC name is 4-(2-bromophenyl)-1,3-dioxole-2-carboxamide.
| Compound Name | 4-(2-bromophenyl)-1,3-dioxole-2-carboxamide |
|---|---|
| PubChem CID | 173096573 |
| Molecular Formula | C10H8BrNO3 |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 4-(2-bromophenyl)-1,3-dioxole-2-carboxamide |
| SMILES | NC(=O)C1OC=C(c2ccccc2Br)O1 |
| InChI | InChI=1S/C10H8BrNO3/c11-7-4-2-1-3-6(7)8-5-14-10(15-8)9(12)13/h1-5,10H,(H2,12,13) |
| InChIKey | ONGHPCOUONGEES-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |