C19H12Cl3F3N4O6S — CID 173096632
[(2S)-1-[2,5-dichloro-4-[5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,2,4-oxadiazol-3-yl]phenoxy]propan-2-yl] sulfate;hydron (PubChem CID 173096632) has the molecular formula C19H12Cl3F3N4O6S and a molecular weight of 587.75 g/mol. Its IUPAC name is [(2S)-1-[2,5-dichloro-4-[5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,2,4-oxadiazol-3-yl]phenoxy]propan-2-yl] sulfate;hydron.
| Compound Name | [(2S)-1-[2,5-dichloro-4-[5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,2,4-oxadiazol-3-yl]phenoxy]propan-2-yl] sulfate;hydron |
|---|---|
| PubChem CID | 173096632 |
| Molecular Formula | C19H12Cl3F3N4O6S |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 585.95 |
| IUPAC Name | [(2S)-1-[2,5-dichloro-4-[5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,2,4-oxadiazol-3-yl]phenoxy]propan-2-yl] sulfate;hydron |
| SMILES | C[C@@H](COc1cc(Cl)c(-c2noc(-c3cn4cc(C(F)(F)F)cc(Cl)c4n3)n2)cc1Cl)OS(=O)(=O)[O-].[H+] |
| InChI | InChI=1S/C19H12Cl3F3N4O6S/c1-8(35-36(30,31)32)7-33-15-4-11(20)10(3-12(15)21)16-27-18(34-28-16)14-6-29-5-9(19(23,24)25)2-13(22)17(29)26-14/h2-6,8H,7H2,1H3,(H,30,31,32)/t8-/m0/s1 |
| InChIKey | RSXYLSLWKJEBCT-QMMMGPOBSA-N |
| XLogP | 5.39 |
| TPSA | 131.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|