C23H19Cl3F3N4O6P — CID 46235154
(4R)-4-[[2,5-dichloro-4-[5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,2,4-oxadiazol-3-yl]phenoxy]methyl]-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 46235154) has the molecular formula C23H19Cl3F3N4O6P and a molecular weight of 641.75 g/mol. Its IUPAC name is (4R)-4-[[2,5-dichloro-4-[5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,2,4-oxadiazol-3-yl]phenoxy]methyl]-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | (4R)-4-[[2,5-dichloro-4-[5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,2,4-oxadiazol-3-yl]phenoxy]methyl]-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 46235154 |
| Molecular Formula | C23H19Cl3F3N4O6P |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 640.01 |
| IUPAC Name | (4R)-4-[[2,5-dichloro-4-[5-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-1,2,4-oxadiazol-3-yl]phenoxy]methyl]-2-[(2-methylpropan-2-yl)oxy]-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | CC(C)(C)OP1(=O)OC[C@@H](COc2cc(Cl)c(-c3noc(-c4cn5cc(C(F)(F)F)cc(Cl)c5n4)n3)cc2Cl)O1 |
| InChI | InChI=1S/C23H19Cl3F3N4O6P/c1-22(2,3)39-40(34)36-10-12(38-40)9-35-18-6-14(24)13(5-15(18)25)19-31-21(37-32-19)17-8-33-7-11(23(27,28)29)4-16(26)20(33)30-17/h4-8,12H,9-10H2,1-3H3/t12-,40?/m1/s1 |
| InChIKey | LLVOJMORWFWXON-FEVXIDPWSA-N |
| XLogP | 7.75 |
| TPSA | 110.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|