C14H30N2O4 — CID 173097881
ethyl 2-amino-6-[bis(2-hydroxypropyl)amino]hexanoate (PubChem CID 173097881) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is ethyl 2-amino-6-[bis(2-hydroxypropyl)amino]hexanoate.
| Compound Name | ethyl 2-amino-6-[bis(2-hydroxypropyl)amino]hexanoate |
|---|---|
| PubChem CID | 173097881 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | ethyl 2-amino-6-[bis(2-hydroxypropyl)amino]hexanoate |
| SMILES | CCOC(=O)C(N)CCCCN(CC(C)O)CC(C)O |
| InChI | InChI=1S/C14H30N2O4/c1-4-20-14(19)13(15)7-5-6-8-16(9-11(2)17)10-12(3)18/h11-13,17-18H,4-10,15H2,1-3H3 |
| InChIKey | AAAHODOEQMAPEI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|