C16H34N2O5 — CID 91801950
tert-butyl 2-amino-6-[2,3-dihydroxypropyl(2-hydroxypropyl)amino]hexanoate (PubChem CID 91801950) has the molecular formula C16H34N2O5 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl 2-amino-6-[2,3-dihydroxypropyl(2-hydroxypropyl)amino]hexanoate.
| Compound Name | tert-butyl 2-amino-6-[2,3-dihydroxypropyl(2-hydroxypropyl)amino]hexanoate |
|---|---|
| PubChem CID | 91801950 |
| Molecular Formula | C16H34N2O5 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | tert-butyl 2-amino-6-[2,3-dihydroxypropyl(2-hydroxypropyl)amino]hexanoate |
| SMILES | CC(O)CN(CCCCC(N)C(=O)OC(C)(C)C)CC(O)CO |
| InChI | InChI=1S/C16H34N2O5/c1-12(20)9-18(10-13(21)11-19)8-6-5-7-14(17)15(22)23-16(2,3)4/h12-14,19-21H,5-11,17H2,1-4H3 |
| InChIKey | LFDLPXNOHSZQET-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|