C34H45N3O3 — CID 173102162
(2R)-2-[[(2S)-2-(1-adamantylamino)-3-phenylpropanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]pentanamide (PubChem CID 173102162) has the molecular formula C34H45N3O3 and a molecular weight of 543.75 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-(1-adamantylamino)-3-phenylpropanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]pentanamide.
| Compound Name | (2R)-2-[[(2S)-2-(1-adamantylamino)-3-phenylpropanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 173102162 |
| Molecular Formula | C34H45N3O3 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.35 |
| IUPAC Name | (2R)-2-[[(2S)-2-(1-adamantylamino)-3-phenylpropanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-phenylpropan-2-yl]pentanamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](Cc1ccccc1)NC12CC3CC(CC(C3)C1)C2)C(=O)N[C@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C34H45N3O3/c1-23(2)13-30(32(39)35-29(22-38)17-24-9-5-3-6-10-24)36-33(40)31(18-25-11-7-4-8-12-25)37-34-19-26-14-27(20-34)16-28(15-26)21-34/h3-12,22-23,26-31,37H,13-21H2,1-2H3,(H,35,39)(H,36,40)/t26?,27?,28?,29-,30+,31-,34?/m0/s1 |
| InChIKey | ZQSWTWFDFZZTSX-XKJADAKJSA-N |
| XLogP | 4.61 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|