About azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane
azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane (PubChem CID 173103101) has the molecular formula C17H27N4O2+
and a molecular weight of 319.43 g/mol. Its IUPAC name is azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane.
Molecular Properties
| Compound Name | azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane |
| PubChem CID | 173103101 |
| Molecular Formula | C17H27N4O2+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane |
| SMILES | C1CCCNCC1.O=[N+]([O-])c1ccc(C23CCC[NH+]2CC3)nc1 |
| InChI | InChI=1S/C11H13N3O2.C6H13N/c15-14(16)9-2-3-10(12-8-9)11-4-1-6-13(11)7-5-11;1-2-4-6-7-5-3-1/h2-3,8H,1,4-7H2;7H,1-6H2/p+1 |
| InChIKey | BGOFMHAXLDPLAM-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane?
The IUPAC name of azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane (CID 173103101) is azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane.
What is the SMILES notation for azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane?
The canonical SMILES for azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane is C1CCCNCC1.O=[N+]([O-])c1ccc(C23CCC[NH+]2CC3)nc1.
What is the InChIKey of azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane?
The InChIKey is BGOFMHAXLDPLAM-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H13N3O2.C6H13N/c15-14(16)9-2-3-10(12-8-9)11-4-1-6-13(11)7-5-11;1-2-4-6-7-5-3-1/h2-3,8H,1,4-7H2;7H,1-6H2/p+1.
What are the key properties of azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane?
azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane has a molecular weight of 319.43 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azepane;5-(5-nitro-2-pyridinyl)-1-azoniabicyclo[3.2.0]heptane is sourced from PubChem (CID 173103101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).