C18H39N3O6 — CID 173104532
2-amino-4-methylpentanoic acid;2-aminopentanoic acid;2-(tert-butylamino)propanoic acid (PubChem CID 173104532) has the molecular formula C18H39N3O6 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;2-aminopentanoic acid;2-(tert-butylamino)propanoic acid.
| Compound Name | 2-amino-4-methylpentanoic acid;2-aminopentanoic acid;2-(tert-butylamino)propanoic acid |
|---|---|
| PubChem CID | 173104532 |
| Molecular Formula | C18H39N3O6 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;2-aminopentanoic acid;2-(tert-butylamino)propanoic acid |
| SMILES | CC(C)CC(N)C(=O)O.CC(NC(C)(C)C)C(=O)O.CCCC(N)C(=O)O |
| InChI | InChI=1S/C7H15NO2.C6H13NO2.C5H11NO2/c1-5(6(9)10)8-7(2,3)4;1-4(2)3-5(7)6(8)9;1-2-3-4(6)5(7)8/h5,8H,1-4H3,(H,9,10);4-5H,3,7H2,1-2H3,(H,8,9);4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | JMWXQWIHEXFIST-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |