C23H27NO — CID 173104696
2-[(8R,9R,10R,13S,14R)-10,13-dimethyl-15,16-dimethylidene-3-oxo-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile (PubChem CID 173104696) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-[(8R,9R,10R,13S,14R)-10,13-dimethyl-15,16-dimethylidene-3-oxo-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile.
| Compound Name | 2-[(8R,9R,10R,13S,14R)-10,13-dimethyl-15,16-dimethylidene-3-oxo-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile |
|---|---|
| PubChem CID | 173104696 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-[(8R,9R,10R,13S,14R)-10,13-dimethyl-15,16-dimethylidene-3-oxo-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile |
| SMILES | C=C1C(=C)[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@H]3CC[C@]2(C)C1=CC#N |
| InChI | InChI=1S/C23H27NO/c1-14-15(2)21-18-6-5-16-13-17(25)7-10-22(16,3)20(18)8-11-23(21,4)19(14)9-12-24/h9,13,18,20-21H,1-2,5-8,10-11H2,3-4H3/t18-,20-,21+,22+,23-/m1/s1 |
| InChIKey | VJDXMIKBHKNLBI-LFDQFFAPSA-N |
| XLogP | 5.30 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|