C13H20ClN3O4 — CID 173104807
[2-hydroxy-5-[2-(methylcarbamoylamino)ethyl]phenyl] N-ethylcarbamate;hydrochloride (PubChem CID 173104807) has the molecular formula C13H20ClN3O4 and a molecular weight of 317.77 g/mol. Its IUPAC name is [2-hydroxy-5-[2-(methylcarbamoylamino)ethyl]phenyl] N-ethylcarbamate;hydrochloride.
| Compound Name | [2-hydroxy-5-[2-(methylcarbamoylamino)ethyl]phenyl] N-ethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 173104807 |
| Molecular Formula | C13H20ClN3O4 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [2-hydroxy-5-[2-(methylcarbamoylamino)ethyl]phenyl] N-ethylcarbamate;hydrochloride |
| SMILES | CCNC(=O)Oc1cc(CCNC(=O)NC)ccc1O.Cl |
| InChI | InChI=1S/C13H19N3O4.ClH/c1-3-15-13(19)20-11-8-9(4-5-10(11)17)6-7-16-12(18)14-2;/h4-5,8,17H,3,6-7H2,1-2H3,(H,15,19)(H2,14,16,18);1H |
| InChIKey | DDDHTSSZSXLSOZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |