C11H16N2O4 — CID 166986653
1-ethyl-3-[2-(3,4,5-trihydroxyphenyl)ethyl]urea (PubChem CID 166986653) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3,4,5-trihydroxyphenyl)ethyl]urea.
| Compound Name | 1-ethyl-3-[2-(3,4,5-trihydroxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 166986653 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-ethyl-3-[2-(3,4,5-trihydroxyphenyl)ethyl]urea |
| SMILES | CCNC(=O)NCCc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C11H16N2O4/c1-2-12-11(17)13-4-3-7-5-8(14)10(16)9(15)6-7/h5-6,14-16H,2-4H2,1H3,(H2,12,13,17) |
| InChIKey | KHVXWBQWJSVHJL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|