C15H21F3N2O2 — CID 110024785
1-(2-hydroxy-3-methylpentyl)-3-[2-(3,4,5-trifluorophenyl)ethyl]urea (PubChem CID 110024785) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-(2-hydroxy-3-methylpentyl)-3-[2-(3,4,5-trifluorophenyl)ethyl]urea.
| Compound Name | 1-(2-hydroxy-3-methylpentyl)-3-[2-(3,4,5-trifluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 110024785 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-(2-hydroxy-3-methylpentyl)-3-[2-(3,4,5-trifluorophenyl)ethyl]urea |
| SMILES | CCC(C)C(O)CNC(=O)NCCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H21F3N2O2/c1-3-9(2)13(21)8-20-15(22)19-5-4-10-6-11(16)14(18)12(17)7-10/h6-7,9,13,21H,3-5,8H2,1-2H3,(H2,19,20,22) |
| InChIKey | KXYRDKHUAIWMJN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|