C16H19F3N2O3 — CID 110026638
N-[3-hydroxy-1-oxo-1-[2-(3,4,5-trifluorophenyl)ethylamino]butan-2-yl]cyclopropanecarboxamide (PubChem CID 110026638) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is N-[3-hydroxy-1-oxo-1-[2-(3,4,5-trifluorophenyl)ethylamino]butan-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[3-hydroxy-1-oxo-1-[2-(3,4,5-trifluorophenyl)ethylamino]butan-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 110026638 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[3-hydroxy-1-oxo-1-[2-(3,4,5-trifluorophenyl)ethylamino]butan-2-yl]cyclopropanecarboxamide |
| SMILES | CC(O)C(NC(=O)C1CC1)C(=O)NCCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H19F3N2O3/c1-8(22)14(21-15(23)10-2-3-10)16(24)20-5-4-9-6-11(17)13(19)12(18)7-9/h6-8,10,14,22H,2-5H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | KNSMAGLLBVUXPJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|