C19H30N2O3 — CID 110013927
N-[1-(1-adamantylmethylamino)-3-hydroxy-1-oxobutan-2-yl]cyclopropanecarboxamide (PubChem CID 110013927) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-[1-(1-adamantylmethylamino)-3-hydroxy-1-oxobutan-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-(1-adamantylmethylamino)-3-hydroxy-1-oxobutan-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 110013927 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N-[1-(1-adamantylmethylamino)-3-hydroxy-1-oxobutan-2-yl]cyclopropanecarboxamide |
| SMILES | CC(O)C(NC(=O)C1CC1)C(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H30N2O3/c1-11(22)16(21-17(23)15-2-3-15)18(24)20-10-19-7-12-4-13(8-19)6-14(5-12)9-19/h11-16,22H,2-10H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | QSDPUOHGUMUJPT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |