C22H30Cl2N2O3S — CID 26918130
(2R)-N-(1-adamantylmethyl)-2-[(2,6-dichlorophenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 26918130) has the molecular formula C22H30Cl2N2O3S and a molecular weight of 473.47 g/mol. Its IUPAC name is (2R)-N-(1-adamantylmethyl)-2-[(2,6-dichlorophenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | (2R)-N-(1-adamantylmethyl)-2-[(2,6-dichlorophenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 26918130 |
| Molecular Formula | C22H30Cl2N2O3S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (2R)-N-(1-adamantylmethyl)-2-[(2,6-dichlorophenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1c(Cl)cccc1Cl)C(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H30Cl2N2O3S/c1-13(2)19(26-30(28,29)20-17(23)4-3-5-18(20)24)21(27)25-12-22-9-14-6-15(10-22)8-16(7-14)11-22/h3-5,13-16,19,26H,6-12H2,1-2H3,(H,25,27)/t14?,15?,16?,19-,22?/m1/s1 |
| InChIKey | FHAAOJKAKQXULS-FRXJQHJJSA-N |
| XLogP | 4.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |