C25H38N2O4 — CID 67687759
methyl 2-[[3-(1-adamantylmethylcarbamoyl)bicyclo[2.2.2]octane-2-carbonyl]amino]propanoate (PubChem CID 67687759) has the molecular formula C25H38N2O4 and a molecular weight of 430.59 g/mol. Its IUPAC name is methyl 2-[[3-(1-adamantylmethylcarbamoyl)bicyclo[2.2.2]octane-2-carbonyl]amino]propanoate.
| Compound Name | methyl 2-[[3-(1-adamantylmethylcarbamoyl)bicyclo[2.2.2]octane-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 67687759 |
| Molecular Formula | C25H38N2O4 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | methyl 2-[[3-(1-adamantylmethylcarbamoyl)bicyclo[2.2.2]octane-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)C1C2CCC(CC2)C1C(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H38N2O4/c1-14(24(30)31-2)27-23(29)21-19-5-3-18(4-6-19)20(21)22(28)26-13-25-10-15-7-16(11-25)9-17(8-15)12-25/h14-21H,3-13H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | DUVIVORPGYNGBX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |