C17H20F3N3O2 — CID 127936791
3-(cyclobutanecarbonylamino)-N-[2-(3,4,5-trifluorophenyl)ethyl]azetidine-1-carboxamide (PubChem CID 127936791) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 3-(cyclobutanecarbonylamino)-N-[2-(3,4,5-trifluorophenyl)ethyl]azetidine-1-carboxamide.
| Compound Name | 3-(cyclobutanecarbonylamino)-N-[2-(3,4,5-trifluorophenyl)ethyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 127936791 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-(cyclobutanecarbonylamino)-N-[2-(3,4,5-trifluorophenyl)ethyl]azetidine-1-carboxamide |
| SMILES | O=C(NC1CN(C(=O)NCCc2cc(F)c(F)c(F)c2)C1)C1CCC1 |
| InChI | InChI=1S/C17H20F3N3O2/c18-13-6-10(7-14(19)15(13)20)4-5-21-17(25)23-8-12(9-23)22-16(24)11-2-1-3-11/h6-7,11-12H,1-5,8-9H2,(H,21,25)(H,22,24) |
| InChIKey | YCNBCAFVUNFMGN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|