C15H21F3N2O2 — CID 110024736
1-(2-hydroxypropyl)-1-propan-2-yl-3-[2-(3,4,5-trifluorophenyl)ethyl]urea (PubChem CID 110024736) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)-1-propan-2-yl-3-[2-(3,4,5-trifluorophenyl)ethyl]urea.
| Compound Name | 1-(2-hydroxypropyl)-1-propan-2-yl-3-[2-(3,4,5-trifluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 110024736 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-(2-hydroxypropyl)-1-propan-2-yl-3-[2-(3,4,5-trifluorophenyl)ethyl]urea |
| SMILES | CC(O)CN(C(=O)NCCc1cc(F)c(F)c(F)c1)C(C)C |
| InChI | InChI=1S/C15H21F3N2O2/c1-9(2)20(8-10(3)21)15(22)19-5-4-11-6-12(16)14(18)13(17)7-11/h6-7,9-10,21H,4-5,8H2,1-3H3,(H,19,22) |
| InChIKey | KTCCBOWZHJISQN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|